![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| TheSyllabusForIntro...> | 2019-01-15 11:53 | 3.7K | |
| IntroToGelogyRocks/ | 2019-01-15 10:06 | - | |
| Chemical Analysis of..> | 2018-12-28 09:38 | 36K | |
| Index.html | 2017-01-17 13:54 | 4.9K | |
| OolitesFromNorthernE..> | 2015-07-02 14:17 | 777K | |
| TadeleAdamScottandAf..> | 2015-07-02 09:39 | 758K | |
| NickAndIllileWalking..> | 2015-07-02 09:28 | 1.1M | |
| AdamAndNickLookingAt..> | 2015-07-01 09:05 | 943K | |
| UnconfromityWithMalo..> | 2015-06-30 14:36 | 880K | |
| SpheroidialWeatherin..> | 2015-06-30 14:21 | 936K | |
| SpheroidialWeatherin..> | 2015-06-30 14:21 | 936K | |
| Introweb/ | 2015-05-27 10:57 | - | |
| GeochemicalEvolution..> | 2015-05-27 10:49 | 778K | |
| Table, figures and m..> | 2014-09-04 08:45 | - | |
| Syllabus.pdf | 2014-09-03 10:50 | 136K | |
| Rules.html | 2014-08-19 18:43 | 3.5K | |
| laboratory.html | 2014-07-03 15:20 | 4.7K | |
| Indexhomework.html | 2014-06-29 11:54 | 1.4K | |
| PillowBasaltUP3.jpg | 2014-06-28 18:15 | 724K | |
| PillowBasaltUP2.jpg | 2014-06-28 18:15 | 921K | |
| PillowBasaltUP1.jpg | 2014-06-28 18:14 | 575K | |
| SpheriodialWeatherin..> | 2014-06-28 18:04 | 772K | |
| Spheroidalweathering..> | 2014-06-28 18:03 | 739K | |
| Sphirodialweathering..> | 2014-06-28 18:03 | 718K | |
| BIF2.jpg | 2014-06-28 17:37 | 3.4M | |
| BIF.jpg | 2014-06-28 17:36 | 2.9M | |
| Whatdoyouseeasageolo..> | 2014-06-28 17:27 | - | |
| Tayllors Falls Great..> | 2014-06-28 16:16 | 356K | |
| Tayllors Falls Mills..> | 2014-06-28 16:16 | 587K | |
| Tayllos Falls Franco..> | 2014-06-28 16:16 | 743K | |
| CRWP Log Crossing.jpg | 2014-06-28 16:15 | 854K | |
| CRWP Springs.jpg | 2014-06-28 16:15 | 656K | |
| AttheBootCamp.jpg | 2014-06-28 15:59 | 345K | |
| St Peter Sandstone.jpg | 2014-06-28 15:57 | 680K | |
| Galena Limestone.jpg | 2014-06-28 15:56 | 1.0M | |
| Plattville Limestone..> | 2014-06-28 15:55 | 851K | |
| _notes/ | 2014-06-19 14:11 | - | |
| untitled.jpg | 2014-06-19 14:11 | 44K | |
| OlDoinyoLangai.jpg | 2013-12-20 15:21 | 877K | |
| Minerals/ | 2013-09-16 08:32 | - | |
| Lab1.html | 2012-12-06 09:07 | 11K | |
| RedwingBarnBluf.jpg | 2012-11-23 14:38 | 1.8M | |
| Lab3.html | 2012-11-23 14:21 | 2.6K | |
| ArmoredMudballs2.jpg | 2012-11-23 14:04 | 970K | |
| Mudcracks.jpg | 2012-11-23 13:56 | 664K | |
| SoilsofSouthernMinne..> | 2012-11-23 13:41 | 1.3M | |
| SoilsofSouthernMinen..> | 2012-11-23 13:39 | 783K | |
| SoilsofSouthernMinen..> | 2012-11-23 13:39 | 783K | |
| Sogn.jpg | 2012-11-23 13:36 | 954K | |
| SyllabusFallwithRule..> | 2012-06-01 13:31 | 127K | |
| syllabus2006.html | 2012-05-26 14:25 | 4.0K | |
| RippleMarksTurkwelRi..> | 2011-08-22 16:13 | 529K | |
| RippleMarksTurkwelRi..> | 2011-08-22 16:13 | 529K | |
| TaylorsFalls2010.jpg | 2011-06-07 10:07 | 921K | |
| ClassProjects.html | 2011-06-06 14:15 | 3.7K | |
| FloodPicturesFall201..> | 2011-05-19 09:50 | 776K | |
| UnconformityLaRueQua..> | 2011-05-17 08:08 | 1.1M | |
| ProjectsFall2010.html | 2011-05-09 15:31 | 1.8K | |
| Fall2010TuesdayLab.pdf | 2011-04-27 15:15 | 4.8M | |
| Fall2010MondayLab.pdf | 2011-04-27 15:09 | 8.9M | |
| TwoAngulraUnconformi..> | 2010-12-18 11:51 | 711K | |
| TaylorsFalls.jpg | 2010-12-18 11:51 | 233K | |
| StillWaterComplexLay..> | 2010-12-18 11:51 | 293K | |
| RoseStructure.jpg | 2010-12-18 11:51 | 644K | |
| RedWingKatiline.jpg | 2010-12-18 11:51 | 389K | |
| Projects.doc | 2010-12-18 11:51 | 22K | |
| PillowLavas.jpg | 2010-12-18 11:51 | 387K | |
| RedWingKatitline.jpg | 2010-12-18 11:51 | 362K | |
| PhotomicrographBasla..> | 2010-12-18 11:51 | 749K | |
| OlduvaiGorgePan.jpg | 2010-12-18 11:51 | 690K | |
| NonConformityTaylors..> | 2010-12-18 11:51 | 679K | |
| MinnesotaSoils.jpg | 2010-12-18 11:51 | 618K | |
| MappingatSogon.jpg | 2010-12-18 11:51 | 481K | |
| FranconiaFormation2.jpg | 2010-12-18 11:51 | 636K | |
| FeldsparSouthDakota2..> | 2010-12-18 11:51 | 554K | |
| FeldesparFromSouthDa..> | 2010-12-18 11:51 | 221K | |
| CannonRiverWildernes..> | 2010-12-18 11:50 | 196K | |
| Boudinage.jpg | 2010-12-18 11:50 | 773K | |
| BandedIronFormation.jpg | 2010-12-18 11:50 | 616K | |
| ArmoredMudBalls.jpg | 2010-12-18 11:50 | 530K | |
| ASingleFeldspar.jpg | 2010-12-18 11:50 | 226K | |
| AngurlaUnconformity1..> | 2010-12-18 11:50 | 701K | |
| AngurlaUnconformity.jpg | 2010-12-18 11:50 | 701K | |
| AngularUnconformity2..> | 2010-12-18 11:50 | 600K | |
| Alanstandingonunconf..> | 2010-12-18 11:50 | 330K | |
| Freshwateralgalbloom..> | 2010-08-10 13:13 | 398K | |
| Links.html | 2010-08-10 11:19 | 8.8K | |
| Projects2006.html | 2010-07-23 10:42 | 1.9K | |
| RoadSalt.pdf | 2010-07-23 10:37 | 12M | |
| Lakes.pdf | 2010-07-23 10:32 | 5.2M | |
| CRWPWinter2006.pdf | 2010-07-23 10:30 | 8.0M | |
| Springcreekfinalpape..> | 2010-07-23 10:25 | 1.5M | |
| Picturesfromfieldtri..> | 2010-07-22 13:51 | 1.5K | |
| AllProjects.pdf | 2010-07-22 13:47 | 84M | |
| ProjectsSpring2010.html | 2010-07-22 13:43 | 2.1K | |
| PlattvilleOutrop.jpg | 2010-07-21 12:26 | 2.0M | |
| Scheduleoftopics.html | 2010-03-26 15:30 | 2.8K | |
| Background1.jpg | 2009-02-25 23:29 | 38K | |
| Super Background.jpg | 2009-02-25 22:38 | 9.4K | |
| St.PeterSandstone.JPG | 2006-09-12 13:44 | 427K | |
| Syllabus.html | 2006-08-29 18:17 | 1.5K | |
| Yui.jpg | 2006-08-15 13:55 | 141K | |
| YSI.jpg | 2006-08-15 13:55 | 120K | |
| BereketsBootCamp.jpg | 2006-08-15 13:54 | 158K | |
| C,CandASingleFeldspa..> | 2006-08-15 13:54 | 91K | |
| watertesting1-copy.jpg | 2006-08-15 13:54 | 177K | |
| RroberdsLake.jpg | 2006-08-15 13:53 | 140K | |
| Photo43.jpg | 2006-08-15 13:53 | 109K | |
| Photo31.jpg | 2006-08-15 13:53 | 182K | |
| Outcropatsogn.jpg | 2006-08-15 13:53 | 173K | |
| MeganW2.jpg | 2006-08-15 13:52 | 54K | |
| MeganW1.jpg | 2006-08-15 13:52 | 60K | |
| IMG_1216-copy.jpg | 2006-08-15 13:52 | 102K | |
| KateM.jpg | 2006-08-15 13:51 | 78K | |
| juliettakingwatersam..> | 2006-08-15 13:51 | 124K | |
| Projects.html | 2006-06-28 10:40 | 2.2K | |
| Projects2004.html | 2006-06-26 10:35 | 2.1K | |
| Projects2003.html | 2006-06-26 10:35 | 3.7K | |
| Projects2005.html | 2006-06-26 10:34 | 2.0K | |
| Soil mapping in Rice..> | 2006-06-25 17:12 | 7.7M | |
| Change in vegetation..> | 2006-06-25 17:12 | 85M | |
| Glauconite project.pdf | 2006-06-25 17:05 | 2.3M | |
| StPeterSandstone.pdf | 2006-06-25 17:03 | 22M | |
| Dischagre in CRWP.pdf | 2006-06-25 17:02 | 14M | |
| Vol of Soil in CRWP.pdf | 2006-06-25 17:01 | 92K | |
| OrdovicianFossils.pdf | 2006-06-25 16:59 | 25M | |
| Springcreekfinalpape..> | 2006-06-25 11:49 | 1.4M | |
| StudyofSnowWinter200..> | 2006-06-25 11:48 | 3.9M | |
| RainwaterfinalRevisi..> | 2006-06-25 11:47 | 8.0M | |
| WalkingOnWaterLakeMi..> | 2006-06-25 11:46 | 8.3M | |
| WalkingOnWaterLakeMi..> | 2006-06-25 11:45 | 612K | |
| WalkingOnWaterLakeMi..> | 2006-06-25 11:45 | 11M | |
| SixRiceCountyLakesWi..> | 2006-06-25 11:44 | 4.7M | |
| CannonRiverWinter200..> | 2006-06-25 11:42 | 8.0M | |
| Indexold.html | 2006-04-10 10:18 | 23K | |
| watertesting1 copy.jpg | 2006-03-06 14:51 | 98K | |
| GalenaLimestone.JPG | 2005-09-27 11:07 | 412K | |
| BereketMojave_DV_Vic..> | 2004-03-26 16:32 | 34K | |
| introimage.jpg | 2004-03-26 16:17 | 100K | |
| 20katja_0208.jpg | 2004-03-26 16:16 | 99K | |
| 23Leah0387.jpg | 2004-03-26 16:16 | 100K | |
| Syllabus 2003 | 2003-09-15 09:44 | 29K | |
| Potholes3.JPG | 2000-01-01 00:00 | 669K | |
| Potholes2.JPG | 2000-01-01 00:00 | 66K | |
| Potholes1.JPG | 2000-01-01 00:00 | 669K | |
| soilalongHWY246.JPG | 1998-12-31 18:00 | 422K | |
| SoilCRWP.JPG | 1998-12-31 18:00 | 437K | |
