![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| _notes/ | 2014-06-20 10:34 | - | |
| definitions/ | 2019-01-21 10:51 | - | |
| Fossils.htm | 2014-07-02 15:04 | 1.3K | |
| IntroToGeologyCommon..> | 2019-04-02 08:12 | 9.9K | |
| IntroToGeologyRocks.htm | 2019-01-21 10:52 | 10K | |
| Sedimentary rocks an..> | 2014-07-17 11:44 | 23K | |
| Cleavage.pdf | 2014-06-29 11:13 | 23K | |
| Chemical Analysis of..> | 2014-04-17 16:44 | 24K | |
| Igneous Rocks.pdf | 2014-07-17 11:05 | 26K | |
| Metamorphism and met..> | 2014-07-17 11:21 | 27K | |
| PlateTectonicsandRoc..> | 2014-06-20 10:34 | 29K | |
| Mohs hardness scale ..> | 2014-06-28 12:03 | 29K | |
| Color Streak Luster.pdf | 2014-06-29 11:16 | 33K | |
| Chemical Analysis of..> | 2018-12-28 09:38 | 36K | |
| Nonsilicates.pdf | 2014-06-29 11:01 | 40K | |
| Biostratigraphy.jpg | 2014-07-02 14:47 | 75K | |
| Figure 18.01.jpg | 2015-01-02 15:50 | 96K | |
| Biostratigraphy2.jpg | 2014-07-02 15:03 | 100K | |
| Metamoprhic Grade.jpg | 2016-09-11 11:58 | 115K | |
| PlateTectonicsandRoc..> | 2014-06-20 10:30 | 121K | |
| Slicate minerals.pdf | 2014-06-29 11:09 | 139K | |
| PlateTectonicsandRoc..> | 2014-06-20 13:56 | 147K | |
| MudstonefromLittleCh..> | 2014-07-02 11:46 | 165K | |
| ShaleFromMojavedeser..> | 2014-07-02 11:50 | 173K | |
| BH250-108.jpg | 2012-11-10 16:22 | 192K | |
| PlateTectonicsandRoc..> | 2014-06-24 13:50 | 213K | |
| BH250-73c.jpg | 2012-06-25 10:46 | 243K | |
| ConcodialFractureInO..> | 2014-07-12 13:57 | 269K | |
| Calcite reacting wit..> | 2014-08-14 12:42 | 269K | |
| Olivineanddunite.jpg | 2014-08-08 14:06 | 317K | |
| CristobaliteinObsidi..> | 2014-07-12 13:59 | 331K | |
| Bh250-97.jpg | 2012-11-10 16:19 | 339K | |
| Muscovite.jpg | 2014-08-07 13:38 | 354K | |
| BH250-109.jpg | 2014-07-02 10:35 | 362K | |
| Quartz.jpg | 2014-08-08 11:43 | 363K | |
| BH250-87.jpg | 2014-07-02 12:06 | 392K | |
| Calcitecleavages2.jpg | 2014-07-07 09:37 | 412K | |
| BH250-112.jpg | 2012-12-19 10:27 | 447K | |
| BH250-60.jpg | 2014-07-02 10:48 | 454K | |
| Ultramfic To Felsic.jpg | 2014-07-06 12:25 | 460K | |
| FromMudToGneiss.jpg | 2014-07-18 11:04 | 481K | |
| Labradorite.jpg | 2014-08-08 11:42 | 482K | |
| BH250-113.jpg | 2014-07-02 10:33 | 483K | |
| MudstonefromLittleCh..> | 2014-07-02 12:07 | 484K | |
| Plagioclase.jpg | 2014-08-12 15:24 | 487K | |
| BH250-180.jpg | 2014-07-02 12:08 | 492K | |
| Muscovitecleavage.jpg | 2014-08-08 11:42 | 492K | |
| alkali feldspars2.jpg | 2014-07-18 10:27 | 495K | |
| Agates.jpg | 2014-07-12 14:06 | 502K | |
| Enestatite016.jpg | 2014-07-12 13:58 | 508K | |
| BH250-152.jpg | 2014-07-02 10:23 | 509K | |
| Agatesbacksides.jpg | 2014-07-12 14:06 | 517K | |
| GrainSizeRoundenss.jpg | 2014-07-17 14:08 | 532K | |
| Breccia.jpg | 2014-07-17 15:40 | 543K | |
| Pyroclasticrocks.jpg | 2014-08-11 09:48 | 556K | |
| BH250-141.jpg | 2014-07-17 12:26 | 561K | |
| BH250-115.jpg | 2014-07-02 10:33 | 568K | |
| Enestatite014.jpg | 2014-07-12 13:59 | 570K | |
| Scoria.jpg | 2014-08-12 15:23 | 607K | |
| Amethesit.jpg | 2014-07-12 14:09 | 607K | |
| BarnBlufRedWing.jpg | 2012-12-06 15:05 | 640K | |
| Plagioclasefeldspars..> | 2014-07-18 10:28 | 655K | |
| BH250-111.jpg | 2014-07-02 10:34 | 658K | |
| Particle Size.jpg | 2014-02-07 15:01 | 670K | |
| TectonicsandRocktype..> | 2014-09-15 08:22 | 675K | |
| BH250-114.jpg | 2013-01-04 13:59 | 679K | |
| BH250-27.jpg | 2014-07-02 10:49 | 681K | |
| PumiceERV005.jpg | 2014-08-11 10:06 | 691K | |
| Pyroclasticrocks2.jpg | 2014-08-11 09:49 | 702K | |
| BH250-123.jpg | 2014-07-02 10:30 | 704K | |
| PlagioclaseLabradori..> | 2014-08-12 15:33 | 723K | |
| PlagioclaseStariatio..> | 2014-08-12 15:33 | 723K | |
| BH250-69.jpg | 2014-07-02 10:43 | 725K | |
| BH250-121 schist2.jpg | 2014-07-03 15:00 | 728K | |
| BH250121schist2.jpg | 2014-07-03 15:00 | 728K | |
| BH250-122.jpg | 2014-07-16 11:29 | 762K | |
| Metamoprhicgrade.jpg | 2014-07-17 16:02 | 777K | |
| Calcite.jpg | 2014-07-07 09:34 | 783K | |
| Enestatite017.jpg | 2014-07-12 13:57 | 793K | |
| OlivineAltaStackUtah..> | 2014-08-09 17:47 | 805K | |
| BH250-158.jpg | 2014-07-01 18:39 | 818K | |
| BH250-90.jpg | 2014-07-02 10:42 | 819K | |
| BH250-165.jpg | 2014-07-01 16:11 | 823K | |
| FeldsparPegmatiteBla..> | 2016-09-25 10:47 | 834K | |
| Plagioclasefeldspar2..> | 2014-07-15 15:03 | 846K | |
| ProgradeMetamorphism..> | 2014-07-17 16:12 | 896K | |
| BH250-179a.jpg | 2014-07-01 16:08 | 896K | |
| Marblequartzite.jpg | 2013-01-08 13:17 | 907K | |
| Biotite.jpg | 2014-08-07 13:35 | 938K | |
| Olivines.jpg | 2015-03-30 16:07 | 1.0M | |
| BH250-153.jpg | 2014-07-02 10:22 | 1.0M | |
| MuscoviteAndQuartzFr..> | 2016-09-25 11:09 | 1.0M | |
| BH250-138.jpg | 2019-01-15 10:04 | 1.0M | |
| Plagioclasefeldspar3..> | 2014-07-15 15:02 | 1.0M | |
| Anorthosite.jpg | 2013-01-08 14:25 | 1.1M | |
| dunite BH250-41.jpg | 2013-01-08 14:25 | 1.1M | |
| Amphiboles.jpg | 2014-08-07 12:21 | 1.1M | |
| Amphibolescleavages.jpg | 2014-08-07 12:24 | 1.1M | |
| Slatephylliteschistg..> | 2013-01-08 13:17 | 1.2M | |
| Obsidian.jpg | 2013-01-08 13:17 | 1.4M | |
| CalciteCleavages.jpg | 2014-07-12 14:03 | 1.5M | |
| Gabbro and Basalt.jpg | 2013-01-07 16:23 | 1.5M | |
| Granite.jpg | 2013-01-07 16:21 | 1.8M | |
| Diorite and Andesite..> | 2013-01-07 16:23 | 1.8M | |
| Rhyolite.jpg | 2013-01-07 16:21 | 1.9M | |
| Calcite plus HCL.mov | 2019-01-15 09:28 | 2.8M | |
| Alkali Feldspars.jpg | 2013-09-03 13:33 | 2.8M | |
| Scanned alkali felds..> | 2013-09-03 13:33 | 2.8M | |
| BH250-46 2.jpg | 2012-12-02 12:13 | 3.2M | |
| BH250-117.jpg | 2012-11-16 11:10 | 4.1M | |
| BH250-121.jpg | 2012-11-16 11:05 | 5.6M | |
| Fossils.jpg | 2013-06-17 10:37 | 6.5M | |
| BH250-110.jpg | 2012-11-16 10:46 | 11M | |
